C27H31N9O2 — CID 171067366
3-[(3-cyano-4-cyclobutyloxyphenyl)methylamino]-N-[3-[[6-(1,2,4-triazol-4-yl)-1H-indazol-4-yl]amino]propyl]propanamide (PubChem CID 171067366) has the molecular formula C27H31N9O2 and a molecular weight of 513.61 g/mol. Its IUPAC name is 3-[(3-cyano-4-cyclobutyloxyphenyl)methylamino]-N-[3-[[6-(1,2,4-triazol-4-yl)-1H-indazol-4-yl]amino]propyl]propanamide.
| Compound Name | 3-[(3-cyano-4-cyclobutyloxyphenyl)methylamino]-N-[3-[[6-(1,2,4-triazol-4-yl)-1H-indazol-4-yl]amino]propyl]propanamide |
|---|---|
| PubChem CID | 171067366 |
| Molecular Formula | C27H31N9O2 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 3-[(3-cyano-4-cyclobutyloxyphenyl)methylamino]-N-[3-[[6-(1,2,4-triazol-4-yl)-1H-indazol-4-yl]amino]propyl]propanamide |
| SMILES | N#Cc1cc(CNCCC(=O)NCCCNc2cc(-n3cnnc3)cc3[nH]ncc23)ccc1OC1CCC1 |
| InChI | InChI=1S/C27H31N9O2/c28-14-20-11-19(5-6-26(20)38-22-3-1-4-22)15-29-10-7-27(37)31-9-2-8-30-24-12-21(36-17-33-34-18-36)13-25-23(24)16-32-35-25/h5-6,11-13,16-18,22,29-30H,1-4,7-10,15H2,(H,31,37)(H,32,35) |
| InChIKey | QYTUWGPHZINMGI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|