About 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole
6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole (PubChem CID 171067813) has the molecular formula C6H5BrFN3
and a molecular weight of 218.03 g/mol. Its IUPAC name is 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole.
Molecular Properties
| Compound Name | 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole |
| PubChem CID | 171067813 |
| Molecular Formula | C6H5BrFN3 |
| Molecular Weight | 218.03 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole |
| SMILES | Fc1cc(Br)cc2c1NNN2 |
| InChI | InChI=1S/C6H5BrFN3/c7-3-1-4(8)6-5(2-3)9-11-10-6/h1-2,9-11H |
| InChIKey | SJSLIOZMEJTWCB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.03 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole?
The IUPAC name of 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole (CID 171067813) is 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole.
What is the SMILES notation for 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole?
The canonical SMILES for 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole is Fc1cc(Br)cc2c1NNN2.
What is the InChIKey of 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole?
The InChIKey is SJSLIOZMEJTWCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrFN3/c7-3-1-4(8)6-5(2-3)9-11-10-6/h1-2,9-11H.
What are the key properties of 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole?
6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole has a molecular weight of 218.03 g/mol, XLogP of 1.85, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-fluoro-2,3-dihydro-1H-benzotriazole is sourced from PubChem (CID 171067813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).