C20H15F3N6O2S — CID 171068504
3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2-pyridinyl]methyl]-5-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,4-oxadiazole-2-thione (PubChem CID 171068504) has the molecular formula C20H15F3N6O2S and a molecular weight of 460.44 g/mol. Its IUPAC name is 3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2-pyridinyl]methyl]-5-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2-pyridinyl]methyl]-5-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 171068504 |
| Molecular Formula | C20H15F3N6O2S |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-fluoro-2-pyridinyl]methyl]-5-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,4-oxadiazole-2-thione |
| SMILES | Fc1cc(-c2nnc(C(F)F)o2)cnc1Cn1nc(-c2ccc3c(c2)CCNC3)oc1=S |
| InChI | InChI=1S/C20H15F3N6O2S/c21-14-6-13(17-26-27-19(30-17)16(22)23)8-25-15(14)9-29-20(32)31-18(28-29)11-1-2-12-7-24-4-3-10(12)5-11/h1-2,5-6,8,16,24H,3-4,7,9H2 |
| InChIKey | AFTTZACYHWMIRH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|