C38H43N7O2 — CID 171068978
(3Z)-3-[7-[[4-[2-(2-amino-3-pyridinyl)-5-[(2E,4Z)-hepta-2,4-dien-3-yl]imidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-4,7-diazaspiro[2.5]octan-4-yl]-4-methoxyhexa-3,5-dien-2-one (PubChem CID 171068978) has the molecular formula C38H43N7O2 and a molecular weight of 629.81 g/mol. Its IUPAC name is (3Z)-3-[7-[[4-[2-(2-amino-3-pyridinyl)-5-[(2E,4Z)-hepta-2,4-dien-3-yl]imidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-4,7-diazaspiro[2.5]octan-4-yl]-4-methoxyhexa-3,5-dien-2-one.
| Compound Name | (3Z)-3-[7-[[4-[2-(2-amino-3-pyridinyl)-5-[(2E,4Z)-hepta-2,4-dien-3-yl]imidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-4,7-diazaspiro[2.5]octan-4-yl]-4-methoxyhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 171068978 |
| Molecular Formula | C38H43N7O2 |
| Molecular Weight | 629.81 g/mol |
| Exact Mass | 629.35 |
| IUPAC Name | (3Z)-3-[7-[[4-[2-(2-amino-3-pyridinyl)-5-[(2E,4Z)-hepta-2,4-dien-3-yl]imidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-4,7-diazaspiro[2.5]octan-4-yl]-4-methoxyhexa-3,5-dien-2-one |
| SMILES | C=C/C(OC)=C(\C(C)=O)N1CCN(Cc2ccc(-n3c(-c4cccnc4N)nc4ccc(C(/C=C\CC)=C/C)nc43)cc2)CC12CC2 |
| InChI | InChI=1S/C38H43N7O2/c1-6-9-11-28(7-2)31-17-18-32-37(41-31)45(36(42-32)30-12-10-21-40-35(30)39)29-15-13-27(14-16-29)24-43-22-23-44(38(25-43)19-20-38)34(26(4)46)33(8-3)47-5/h7-18,21H,3,6,19-20,22-25H2,1-2,4-5H3,(H2,39,40)/b11-9-,28-7+,34-33- |
| InChIKey | LXCYJSSKXXFPIH-HOKFNSMYSA-N |
| XLogP | 6.72 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.81 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|