C16H29N3 — CID 171069334
ethane;N-[(1Z,3Z)-1-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)penta-1,3-dienyl]methanimine (PubChem CID 171069334) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is ethane;N-[(1Z,3Z)-1-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)penta-1,3-dienyl]methanimine.
| Compound Name | ethane;N-[(1Z,3Z)-1-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 171069334 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | ethane;N-[(1Z,3Z)-1-(2-methyl-2,7-diazaspiro[3.5]nonan-7-yl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C(=C\C=C/C)N1CCC2(CC1)CN(C)C2.CC |
| InChI | InChI=1S/C14H23N3.C2H6/c1-4-5-6-13(15-2)17-9-7-14(8-10-17)11-16(3)12-14;1-2/h4-6H,2,7-12H2,1,3H3;1-2H3/b5-4-,13-6+; |
| InChIKey | BQMZJJGWAMQEGB-PMBKMLQFSA-N |
| XLogP | 3.16 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|