C18H31N5 — CID 171069404
2-[1-[4-(azetidin-3-ylmethyl)piperazin-1-yl]cyclopropyl]-5-methylpyrimidine;ethane (PubChem CID 171069404) has the molecular formula C18H31N5 and a molecular weight of 317.48 g/mol. Its IUPAC name is 2-[1-[4-(azetidin-3-ylmethyl)piperazin-1-yl]cyclopropyl]-5-methylpyrimidine;ethane.
| Compound Name | 2-[1-[4-(azetidin-3-ylmethyl)piperazin-1-yl]cyclopropyl]-5-methylpyrimidine;ethane |
|---|---|
| PubChem CID | 171069404 |
| Molecular Formula | C18H31N5 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 2-[1-[4-(azetidin-3-ylmethyl)piperazin-1-yl]cyclopropyl]-5-methylpyrimidine;ethane |
| SMILES | CC.Cc1cnc(C2(N3CCN(CC4CNC4)CC3)CC2)nc1 |
| InChI | InChI=1S/C16H25N5.C2H6/c1-13-8-18-15(19-9-13)16(2-3-16)21-6-4-20(5-7-21)12-14-10-17-11-14;1-2/h8-9,14,17H,2-7,10-12H2,1H3;1-2H3 |
| InChIKey | JWNNNMPRKFCGAG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |