C23H44N4 — CID 171069474
7-[[(9Z,11E)-1,7-diazacyclododeca-7,9,11-trien-4-yl]methyl]-2,7-diazaspiro[3.5]nonane;ethane;propane (PubChem CID 171069474) has the molecular formula C23H44N4 and a molecular weight of 376.63 g/mol. Its IUPAC name is 7-[[(9Z,11E)-1,7-diazacyclododeca-7,9,11-trien-4-yl]methyl]-2,7-diazaspiro[3.5]nonane;ethane;propane.
| Compound Name | 7-[[(9Z,11E)-1,7-diazacyclododeca-7,9,11-trien-4-yl]methyl]-2,7-diazaspiro[3.5]nonane;ethane;propane |
|---|---|
| PubChem CID | 171069474 |
| Molecular Formula | C23H44N4 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.36 |
| IUPAC Name | 7-[[(9Z,11E)-1,7-diazacyclododeca-7,9,11-trien-4-yl]methyl]-2,7-diazaspiro[3.5]nonane;ethane;propane |
| SMILES | C1=C\C=N\CCC(CN2CCC3(CC2)CNC3)CCN/C=C/1.CC.CCC |
| InChI | InChI=1S/C18H30N4.C3H8.C2H6/c1-2-8-19-10-4-17(5-11-20-9-3-1)14-22-12-6-18(7-13-22)15-21-16-18;1-3-2;1-2/h1-3,8-9,17,19,21H,4-7,10-16H2;3H2,1-2H3;1-2H3/b3-1-,8-2+,20-9+;; |
| InChIKey | DLXVAKRPQNGCCL-LNPQMXJMSA-N |
| XLogP | 4.25 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |