C16H24N2 — CID 171069499
1-[(1-phenylpyrrolidin-3-yl)methyl]piperidine (PubChem CID 171069499) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-[(1-phenylpyrrolidin-3-yl)methyl]piperidine.
| Compound Name | 1-[(1-phenylpyrrolidin-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 171069499 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-[(1-phenylpyrrolidin-3-yl)methyl]piperidine |
| SMILES | c1ccc(N2CCC(CN3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C16H24N2/c1-3-7-16(8-4-1)18-12-9-15(14-18)13-17-10-5-2-6-11-17/h1,3-4,7-8,15H,2,5-6,9-14H2 |
| InChIKey | CEIHJAYGGPONKG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |