C22H43N5 — CID 171070218
2-[1-[4-(azetidin-3-ylmethyl)piperazin-1-yl]cyclopropyl]-5-methylpyrimidine;ethane (PubChem CID 171070218) has the molecular formula C22H43N5 and a molecular weight of 377.62 g/mol. Its IUPAC name is 2-[1-[4-(azetidin-3-ylmethyl)piperazin-1-yl]cyclopropyl]-5-methylpyrimidine;ethane.
| Compound Name | 2-[1-[4-(azetidin-3-ylmethyl)piperazin-1-yl]cyclopropyl]-5-methylpyrimidine;ethane |
|---|---|
| PubChem CID | 171070218 |
| Molecular Formula | C22H43N5 |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.35 |
| IUPAC Name | 2-[1-[4-(azetidin-3-ylmethyl)piperazin-1-yl]cyclopropyl]-5-methylpyrimidine;ethane |
| SMILES | CC.CC.CC.Cc1cnc(C2(N3CCN(CC4CNC4)CC3)CC2)nc1 |
| InChI | InChI=1S/C16H25N5.3C2H6/c1-13-8-18-15(19-9-13)16(2-3-16)21-6-4-20(5-7-21)12-14-10-17-11-14;3*1-2/h8-9,14,17H,2-7,10-12H2,1H3;3*1-2H3 |
| InChIKey | ICAAKGQZKBTGAR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |