C26H30N6OS — CID 171071179
1-ethanimidoyl-6,7-dimethyl-3-(1,3-oxazol-2-ylmethyl)-5-(4-piperidin-1-ylphenyl)-3H-thieno[2,3-e][1,4]diazepin-2-imine (PubChem CID 171071179) has the molecular formula C26H30N6OS and a molecular weight of 474.63 g/mol. Its IUPAC name is 1-ethanimidoyl-6,7-dimethyl-3-(1,3-oxazol-2-ylmethyl)-5-(4-piperidin-1-ylphenyl)-3H-thieno[2,3-e][1,4]diazepin-2-imine.
| Compound Name | 1-ethanimidoyl-6,7-dimethyl-3-(1,3-oxazol-2-ylmethyl)-5-(4-piperidin-1-ylphenyl)-3H-thieno[2,3-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 171071179 |
| Molecular Formula | C26H30N6OS |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 1-ethanimidoyl-6,7-dimethyl-3-(1,3-oxazol-2-ylmethyl)-5-(4-piperidin-1-ylphenyl)-3H-thieno[2,3-e][1,4]diazepin-2-imine |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])C(Cc2ncco2)N=C(c2ccc(N3CCCCC3)cc2)c2c1sc(C)c2C |
| InChI | InChI=1S/C26H30N6OS/c1-16-17(2)34-26-23(16)24(19-7-9-20(10-8-19)31-12-5-4-6-13-31)30-21(15-22-29-11-14-33-22)25(28)32(26)18(3)27/h7-11,14,21,27-28H,4-6,12-13,15H2,1-3H3/b27-18+,28-25+ |
| InChIKey | OZQOXUYUCLKGEH-TVLFCFFTSA-N |
| XLogP | 5.59 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|