C21H16F5N3O3S — CID 171072150
2-fluoro-6-[(6-fluoro-2-methyl-3-pyridinyl)oxy]-N-[3-(methylsulfonimidoyl)phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 171072150) has the molecular formula C21H16F5N3O3S and a molecular weight of 485.43 g/mol. Its IUPAC name is 2-fluoro-6-[(6-fluoro-2-methyl-3-pyridinyl)oxy]-N-[3-(methylsulfonimidoyl)phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-fluoro-6-[(6-fluoro-2-methyl-3-pyridinyl)oxy]-N-[3-(methylsulfonimidoyl)phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171072150 |
| Molecular Formula | C21H16F5N3O3S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2-fluoro-6-[(6-fluoro-2-methyl-3-pyridinyl)oxy]-N-[3-(methylsulfonimidoyl)phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | [H]N=[S@](C)(=O)c1cccc(NC(=O)c2c(Oc3ccc(F)nc3C)ccc(C(F)(F)F)c2F)c1 |
| InChI | InChI=1S/C21H16F5N3O3S/c1-11-15(8-9-17(22)28-11)32-16-7-6-14(21(24,25)26)19(23)18(16)20(30)29-12-4-3-5-13(10-12)33(2,27)31/h3-10,27H,1-2H3,(H,29,30)/t33-/m1/s1 |
| InChIKey | BIBBNLVIERMICL-MGBGTMOVSA-N |
| XLogP | 5.77 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|