C16H12F6N2O3 — CID 171072239
methyl 2-[(6-fluoro-2-methyl-3-pyridinyl)oxy]-4-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carboxylate (PubChem CID 171072239) has the molecular formula C16H12F6N2O3 and a molecular weight of 394.27 g/mol. Its IUPAC name is methyl 2-[(6-fluoro-2-methyl-3-pyridinyl)oxy]-4-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-[(6-fluoro-2-methyl-3-pyridinyl)oxy]-4-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 171072239 |
| Molecular Formula | C16H12F6N2O3 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | methyl 2-[(6-fluoro-2-methyl-3-pyridinyl)oxy]-4-methyl-5-(1,1,2,2,2-pentafluoroethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(Oc2ccc(F)nc2C)ncc(C(F)(F)C(F)(F)F)c1C |
| InChI | InChI=1S/C16H12F6N2O3/c1-7-9(15(18,19)16(20,21)22)6-23-13(12(7)14(25)26-3)27-10-4-5-11(17)24-8(10)2/h4-6H,1-3H3 |
| InChIKey | HDJWGNVFEDBZAR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|