About methylaminomethyl 3-ethylpyrrolidine-1-carboxylate
methylaminomethyl 3-ethylpyrrolidine-1-carboxylate (PubChem CID 171073093) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is methylaminomethyl 3-ethylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | methylaminomethyl 3-ethylpyrrolidine-1-carboxylate |
| PubChem CID | 171073093 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | methylaminomethyl 3-ethylpyrrolidine-1-carboxylate |
| SMILES | CCC1CCN(C(=O)OCNC)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-3-8-4-5-11(6-8)9(12)13-7-10-2/h8,10H,3-7H2,1-2H3 |
| InChIKey | IKALJADONBNDDX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methylaminomethyl 3-ethylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylaminomethyl 3-ethylpyrrolidine-1-carboxylate?
The IUPAC name of methylaminomethyl 3-ethylpyrrolidine-1-carboxylate (CID 171073093) is methylaminomethyl 3-ethylpyrrolidine-1-carboxylate.
What is the SMILES notation for methylaminomethyl 3-ethylpyrrolidine-1-carboxylate?
The canonical SMILES for methylaminomethyl 3-ethylpyrrolidine-1-carboxylate is CCC1CCN(C(=O)OCNC)C1.
What is the InChIKey of methylaminomethyl 3-ethylpyrrolidine-1-carboxylate?
The InChIKey is IKALJADONBNDDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-3-8-4-5-11(6-8)9(12)13-7-10-2/h8,10H,3-7H2,1-2H3.
What are the key properties of methylaminomethyl 3-ethylpyrrolidine-1-carboxylate?
methylaminomethyl 3-ethylpyrrolidine-1-carboxylate has a molecular weight of 186.25 g/mol, XLogP of 1.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylaminomethyl 3-ethylpyrrolidine-1-carboxylate is sourced from PubChem (CID 171073093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).