About 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine
10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine (PubChem CID 171073426) has the molecular formula C31H19F6N3S
and a molecular weight of 579.57 g/mol. Its IUPAC name is 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine.
Molecular Properties
| Compound Name | 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine |
| PubChem CID | 171073426 |
| Molecular Formula | C31H19F6N3S |
| Molecular Weight | 579.57 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine |
| SMILES | CN1c2ccc(-c3ccc4[nH]c(C(F)(F)F)cc4c3)cc2Sc2cc(-c3ccc4[nH]c(C(F)(F)F)cc4c3)ccc21 |
| InChI | InChI=1S/C31H19F6N3S/c1-40-24-8-4-18(16-2-6-22-20(10-16)14-28(38-22)30(32,33)34)12-26(24)41-27-13-19(5-9-25(27)40)17-3-7-23-21(11-17)15-29(39-23)31(35,36)37/h2-15,38-39H,1H3 |
| InChIKey | MTODWEUSZBVJLB-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 579.57 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine?
The IUPAC name of 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine (CID 171073426) is 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine.
What is the SMILES notation for 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine?
The canonical SMILES for 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine is CN1c2ccc(-c3ccc4[nH]c(C(F)(F)F)cc4c3)cc2Sc2cc(-c3ccc4[nH]c(C(F)(F)F)cc4c3)ccc21.
What is the InChIKey of 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine?
The InChIKey is MTODWEUSZBVJLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H19F6N3S/c1-40-24-8-4-18(16-2-6-22-20(10-16)14-28(38-22)30(32,33)34)12-26(24)41-27-13-19(5-9-25(27)40)17-3-7-23-21(11-17)15-29(39-23)31(35,36)37/h2-15,38-39H,1H3.
What are the key properties of 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine?
10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine has a molecular weight of 579.57 g/mol, XLogP of 10.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-3,7-bis[2-(trifluoromethyl)-1H-indol-5-yl]phenothiazine is sourced from PubChem (CID 171073426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).