C30H24N4O2S — CID 171073477
3,7-bis(5-methoxy-1H-indol-2-yl)-10-methylpyrido[3,2-b][1,4]benzothiazine (PubChem CID 171073477) has the molecular formula C30H24N4O2S and a molecular weight of 504.62 g/mol. Its IUPAC name is 3,7-bis(5-methoxy-1H-indol-2-yl)-10-methylpyrido[3,2-b][1,4]benzothiazine.
| Compound Name | 3,7-bis(5-methoxy-1H-indol-2-yl)-10-methylpyrido[3,2-b][1,4]benzothiazine |
|---|---|
| PubChem CID | 171073477 |
| Molecular Formula | C30H24N4O2S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 3,7-bis(5-methoxy-1H-indol-2-yl)-10-methylpyrido[3,2-b][1,4]benzothiazine |
| SMILES | COc1ccc2[nH]c(-c3ccc4c(c3)Sc3cc(-c5cc6cc(OC)ccc6[nH]5)cnc3N4C)cc2c1 |
| InChI | InChI=1S/C30H24N4O2S/c1-34-27-9-4-17(25-12-18-10-21(35-2)5-7-23(18)32-25)14-28(27)37-29-15-20(16-31-30(29)34)26-13-19-11-22(36-3)6-8-24(19)33-26/h4-16,32-33H,1-3H3 |
| InChIKey | FMPXPHGNJASVBH-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 66.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |