C34H30N4O2 — CID 171073548
2,8-bis(1H-indol-5-yl)-10-(2-morpholin-4-ylethyl)phenoxazine (PubChem CID 171073548) has the molecular formula C34H30N4O2 and a molecular weight of 526.64 g/mol. Its IUPAC name is 2,8-bis(1H-indol-5-yl)-10-(2-morpholin-4-ylethyl)phenoxazine.
| Compound Name | 2,8-bis(1H-indol-5-yl)-10-(2-morpholin-4-ylethyl)phenoxazine |
|---|---|
| PubChem CID | 171073548 |
| Molecular Formula | C34H30N4O2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 2,8-bis(1H-indol-5-yl)-10-(2-morpholin-4-ylethyl)phenoxazine |
| SMILES | c1cc2cc(-c3ccc4c(c3)N(CCN3CCOCC3)c3cc(-c5ccc6[nH]ccc6c5)ccc3O4)ccc2[nH]1 |
| InChI | InChI=1S/C34H30N4O2/c1-5-29-27(9-11-35-29)19-23(1)25-3-7-33-31(21-25)38(14-13-37-15-17-39-18-16-37)32-22-26(4-8-34(32)40-33)24-2-6-30-28(20-24)10-12-36-30/h1-12,19-22,35-36H,13-18H2 |
| InChIKey | SBVLPKACUCDVIE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'} |
|---|