About N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide
N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide (PubChem CID 171073943) has the molecular formula C9H17F3N2O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide |
| PubChem CID | 171073943 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide |
| SMILES | CCN(CCO)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-2-14(6-7-15)5-3-4-13-8(16)9(10,11)12/h15H,2-7H2,1H3,(H,13,16) |
| InChIKey | ZZWFUEVGSXBJPR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide (CID 171073943) is N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide is CCN(CCO)CCCNC(=O)C(F)(F)F.
What is the InChIKey of N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide?
The InChIKey is ZZWFUEVGSXBJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O2/c1-2-14(6-7-15)5-3-4-13-8(16)9(10,11)12/h15H,2-7H2,1H3,(H,13,16).
What are the key properties of N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide?
N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide has a molecular weight of 242.24 g/mol, XLogP of 0.37, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[ethyl(2-hydroxyethyl)amino]propyl]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 171073943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).