C26H29ClF3N3O5S — CID 171074273
5-chloro-3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-[4-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-1,3-benzothiazol-2-yl]benzamide (PubChem CID 171074273) has the molecular formula C26H29ClF3N3O5S and a molecular weight of 588.05 g/mol. Its IUPAC name is 5-chloro-3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-[4-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 5-chloro-3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-[4-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 171074273 |
| Molecular Formula | C26H29ClF3N3O5S |
| Molecular Weight | 588.05 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | 5-chloro-3-[[(2S,6R)-2,6-dimethylmorpholin-4-yl]methyl]-2-hydroxy-N-[4-(2-methoxyethoxymethyl)-6-(trifluoromethyl)-1,3-benzothiazol-2-yl]benzamide |
| SMILES | COCCOCc1cc(C(F)(F)F)cc2sc(NC(=O)c3cc(Cl)cc(CN4C[C@@H](C)O[C@@H](C)C4)c3O)nc12 |
| InChI | InChI=1S/C26H29ClF3N3O5S/c1-14-10-33(11-15(2)38-14)12-16-7-19(27)9-20(23(16)34)24(35)32-25-31-22-17(13-37-5-4-36-3)6-18(26(28,29)30)8-21(22)39-25/h6-9,14-15,34H,4-5,10-13H2,1-3H3,(H,31,32,35)/t14-,15+ |
| InChIKey | LRHDINQJZFFRPY-GASCZTMLSA-N |
| XLogP | 5.70 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.05 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|