C24H21N5O4 — CID 171075340
3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1-methylpyrazol-5-yl]benzamide (PubChem CID 171075340) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1-methylpyrazol-5-yl]benzamide.
| Compound Name | 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1-methylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 171075340 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-1-methylpyrazol-5-yl]benzamide |
| SMILES | Cn1ncc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1-c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C24H21N5O4/c1-28-21(14-3-2-4-15(10-14)22(25)31)18(11-26-28)13-5-6-17-16(9-13)12-29(24(17)33)19-7-8-20(30)27-23(19)32/h2-6,9-11,19H,7-8,12H2,1H3,(H2,25,31)(H,27,30,32) |
| InChIKey | UPPBEYCHGONACL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|