C21H17ClN4O3S — CID 171075422
3-[6-[5-(5-chlorothiophen-2-yl)-1-methylpyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171075422) has the molecular formula C21H17ClN4O3S and a molecular weight of 440.91 g/mol. Its IUPAC name is 3-[6-[5-(5-chlorothiophen-2-yl)-1-methylpyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-(5-chlorothiophen-2-yl)-1-methylpyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171075422 |
| Molecular Formula | C21H17ClN4O3S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 3-[6-[5-(5-chlorothiophen-2-yl)-1-methylpyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1ncc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1-c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H17ClN4O3S/c1-25-19(16-5-6-17(22)30-16)14(9-23-25)11-2-3-13-12(8-11)10-26(21(13)29)15-4-7-18(27)24-20(15)28/h2-3,5-6,8-9,15H,4,7,10H2,1H3,(H,24,27,28) |
| InChIKey | CJANCENUXQXHQJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|