C24H20F2N4O4 — CID 171075932
3-[6-[5-[4-(difluoromethoxy)phenyl]-1-(trideuteriomethyl)pyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171075932) has the molecular formula C24H20F2N4O4 and a molecular weight of 469.46 g/mol. Its IUPAC name is 3-[6-[5-[4-(difluoromethoxy)phenyl]-1-(trideuteriomethyl)pyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-[4-(difluoromethoxy)phenyl]-1-(trideuteriomethyl)pyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171075932 |
| Molecular Formula | C24H20F2N4O4 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 3-[6-[5-[4-(difluoromethoxy)phenyl]-1-(trideuteriomethyl)pyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C([2H])([2H])n1ncc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H20F2N4O4/c1-29-21(13-2-5-16(6-3-13)34-24(25)26)18(11-27-29)14-4-7-17-15(10-14)12-30(23(17)33)19-8-9-20(31)28-22(19)32/h2-7,10-11,19,24H,8-9,12H2,1H3,(H,28,31,32)/i1D3 |
| InChIKey | SHLVKKOTALYMMS-FIBGUPNXSA-N |
| XLogP | 3.12 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|