About methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide
methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide (PubChem CID 171076524) has the molecular formula C15H12BrFIN3OS
and a molecular weight of 508.15 g/mol. Its IUPAC name is methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide.
Molecular Properties
| Compound Name | methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide |
| PubChem CID | 171076524 |
| Molecular Formula | C15H12BrFIN3OS |
| Molecular Weight | 508.15 g/mol |
| Exact Mass | 506.89 |
| IUPAC Name | methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide |
| SMILES | I.[H]/N=C(\SC)c1cc(Oc2ncc3[nH]ccc3c2Br)ccc1F |
| InChI | InChI=1S/C15H11BrFN3OS.HI/c1-22-14(18)10-6-8(2-3-11(10)17)21-15-13(16)9-4-5-19-12(9)7-20-15;/h2-7,18-19H,1H3;1H/b18-14-; |
| InChIKey | GSARLHMDFQYIIH-NYAKATHWSA-N |
| XLogP | 5.56 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.15 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide?
The IUPAC name of methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide (CID 171076524) is methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide.
What is the SMILES notation for methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide?
The canonical SMILES for methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide is I.[H]/N=C(\SC)c1cc(Oc2ncc3[nH]ccc3c2Br)ccc1F.
What is the InChIKey of methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide?
The InChIKey is GSARLHMDFQYIIH-NYAKATHWSA-N. The full InChI is InChI=1S/C15H11BrFN3OS.HI/c1-22-14(18)10-6-8(2-3-11(10)17)21-15-13(16)9-4-5-19-12(9)7-20-15;/h2-7,18-19H,1H3;1H/b18-14-;.
What are the key properties of methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide?
methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide has a molecular weight of 508.15 g/mol, XLogP of 5.56, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(4-bromo-1H-pyrrolo[2,3-c]pyridin-5-yl)oxy]-2-fluorobenzenecarboximidothioate;hydroiodide is sourced from PubChem (CID 171076524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).