C28H50BrFN2O5Si — CID 171077316
[(5S)-5-amino-5-carboxypentyl]azanium;(2R)-2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate (PubChem CID 171077316) has the molecular formula C28H50BrFN2O5Si and a molecular weight of 621.71 g/mol. Its IUPAC name is [(5S)-5-amino-5-carboxypentyl]azanium;(2R)-2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate.
| Compound Name | [(5S)-5-amino-5-carboxypentyl]azanium;(2R)-2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate |
|---|---|
| PubChem CID | 171077316 |
| Molecular Formula | C28H50BrFN2O5Si |
| Molecular Weight | 621.71 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | [(5S)-5-amino-5-carboxypentyl]azanium;(2R)-2-(3-bromo-2-fluorophenyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptanoate |
| SMILES | CC(C)(CCC[C@@](C)(C(=O)[O-])c1cccc(Br)c1F)CO[Si](C)(C)C(C)(C)C.N[C@@H](CCCC[NH3+])C(=O)O |
| InChI | InChI=1S/C22H36BrFO3Si.C6H14N2O2/c1-20(2,3)28(7,8)27-15-21(4,5)13-10-14-22(6,19(25)26)16-11-9-12-17(23)18(16)24;7-4-2-1-3-5(8)6(9)10/h9,11-12H,10,13-15H2,1-8H3,(H,25,26);5H,1-4,7-8H2,(H,9,10)/t22-;5-/m10/s1 |
| InChIKey | ZSFRHCQDDNIXDH-DYMWHFOISA-N |
| XLogP | 4.62 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|