C33H33F2N3O2 — CID 171078024
21,27-difluoro-6,12,12-trimethyl-6-phenyl-10,23-dioxa-3,18,29-triazapentacyclo[22.3.1.12,5.014,22.015,19]nonacosa-1(27),2,4,14,16,19,21,24(28),25-nonaene (PubChem CID 171078024) has the molecular formula C33H33F2N3O2 and a molecular weight of 541.64 g/mol. Its IUPAC name is 21,27-difluoro-6,12,12-trimethyl-6-phenyl-10,23-dioxa-3,18,29-triazapentacyclo[22.3.1.12,5.014,22.015,19]nonacosa-1(27),2,4,14,16,19,21,24(28),25-nonaene.
| Compound Name | 21,27-difluoro-6,12,12-trimethyl-6-phenyl-10,23-dioxa-3,18,29-triazapentacyclo[22.3.1.12,5.014,22.015,19]nonacosa-1(27),2,4,14,16,19,21,24(28),25-nonaene |
|---|---|
| PubChem CID | 171078024 |
| Molecular Formula | C33H33F2N3O2 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 21,27-difluoro-6,12,12-trimethyl-6-phenyl-10,23-dioxa-3,18,29-triazapentacyclo[22.3.1.12,5.014,22.015,19]nonacosa-1(27),2,4,14,16,19,21,24(28),25-nonaene |
| SMILES | CC1(C)COCCCC(C)(c2ccccc2)c2cnc([nH]2)-c2cc(ccc2F)Oc2c(F)cc3[nH]ccc3c2C1 |
| InChI | InChI=1S/C33H33F2N3O2/c1-32(2)18-25-23-12-14-36-28(23)17-27(35)30(25)40-22-10-11-26(34)24(16-22)31-37-19-29(38-31)33(3,13-7-15-39-20-32)21-8-5-4-6-9-21/h4-6,8-12,14,16-17,19,36H,7,13,15,18,20H2,1-3H3,(H,37,38) |
| InChIKey | BJKGJFJFEXYTNM-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |