About methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate
methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate (PubChem CID 171078351) has the molecular formula C21H21F2N3O3
and a molecular weight of 401.41 g/mol. Its IUPAC name is methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate |
| PubChem CID | 171078351 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate |
| SMILES | [H]/N=C(\N)c1cc(Oc2c(F)cc3[nH]ccc3c2CC(C)(C)C(=O)OC)ccc1F |
| InChI | InChI=1S/C21H21F2N3O3/c1-21(2,20(27)28-3)10-14-12-6-7-26-17(12)9-16(23)18(14)29-11-4-5-15(22)13(8-11)19(24)25/h4-9,26H,10H2,1-3H3,(H3,24,25) |
| InChIKey | UZYRNYZDVPCYRU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate (CID 171078351) is methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate is [H]/N=C(\N)c1cc(Oc2c(F)cc3[nH]ccc3c2CC(C)(C)C(=O)OC)ccc1F.
What is the InChIKey of methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate?
The InChIKey is UZYRNYZDVPCYRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F2N3O3/c1-21(2,20(27)28-3)10-14-12-6-7-26-17(12)9-16(23)18(14)29-11-4-5-15(22)13(8-11)19(24)25/h4-9,26H,10H2,1-3H3,(H3,24,25).
What are the key properties of methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate?
methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate has a molecular weight of 401.41 g/mol, XLogP of 4.26, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5-(3-carbamimidoyl-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]-2,2-dimethylpropanoate is sourced from PubChem (CID 171078351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).