C23H39IO3Si — CID 171078820
(2R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(3-iodophenyl)-2,7,7-trimethyloctanoic acid (PubChem CID 171078820) has the molecular formula C23H39IO3Si and a molecular weight of 518.55 g/mol. Its IUPAC name is (2R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(3-iodophenyl)-2,7,7-trimethyloctanoic acid.
| Compound Name | (2R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(3-iodophenyl)-2,7,7-trimethyloctanoic acid |
|---|---|
| PubChem CID | 171078820 |
| Molecular Formula | C23H39IO3Si |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | (2R)-8-[tert-butyl(dimethyl)silyl]oxy-2-(3-iodophenyl)-2,7,7-trimethyloctanoic acid |
| SMILES | CC(C)(CCCC[C@@](C)(C(=O)O)c1cccc(I)c1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39IO3Si/c1-21(2,3)28(7,8)27-17-22(4,5)14-9-10-15-23(6,20(25)26)18-12-11-13-19(24)16-18/h11-13,16H,9-10,14-15,17H2,1-8H3,(H,25,26)/t23-/m1/s1 |
| InChIKey | JFTXHXQSFQYZCH-HSZRJFAPSA-N |
| XLogP | 7.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|