C18H36N4S2 — CID 171080470
2-[2-[4-[2-(2-aminoethylsulfanyl)ethyl]-2,5-bis(prop-2-enyl)piperazin-1-yl]ethylsulfanyl]ethanamine (PubChem CID 171080470) has the molecular formula C18H36N4S2 and a molecular weight of 372.65 g/mol. Its IUPAC name is 2-[2-[4-[2-(2-aminoethylsulfanyl)ethyl]-2,5-bis(prop-2-enyl)piperazin-1-yl]ethylsulfanyl]ethanamine.
| Compound Name | 2-[2-[4-[2-(2-aminoethylsulfanyl)ethyl]-2,5-bis(prop-2-enyl)piperazin-1-yl]ethylsulfanyl]ethanamine |
|---|---|
| PubChem CID | 171080470 |
| Molecular Formula | C18H36N4S2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 2-[2-[4-[2-(2-aminoethylsulfanyl)ethyl]-2,5-bis(prop-2-enyl)piperazin-1-yl]ethylsulfanyl]ethanamine |
| SMILES | C=CCC1CN(CCSCCN)C(CC=C)CN1CCSCCN |
| InChI | InChI=1S/C18H36N4S2/c1-3-5-17-15-22(10-14-24-12-8-20)18(6-4-2)16-21(17)9-13-23-11-7-19/h3-4,17-18H,1-2,5-16,19-20H2 |
| InChIKey | JWOXBKWNMREINZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|