C16H32N2O2 — CID 171081075
ethane;N'-[3-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]propyl]-N-methylethane-1,2-diamine (PubChem CID 171081075) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is ethane;N'-[3-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]propyl]-N-methylethane-1,2-diamine.
| Compound Name | ethane;N'-[3-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]propyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 171081075 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | ethane;N'-[3-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]propyl]-N-methylethane-1,2-diamine |
| SMILES | C=C/C=C\C(=C)OCCOCCCNCCNC.CC |
| InChI | InChI=1S/C14H26N2O2.C2H6/c1-4-5-7-14(2)18-13-12-17-11-6-8-16-10-9-15-3;1-2/h4-5,7,15-16H,1-2,6,8-13H2,3H3;1-2H3/b7-5-; |
| InChIKey | FXIAHOSOIFBVMB-YJOCEBFMSA-N |
| XLogP | 2.50 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|