C14H26N2O2 — CID 171081076
N'-[3-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]propyl]-N-methylethane-1,2-diamine (PubChem CID 171081076) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is N'-[3-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]propyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[3-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]propyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 171081076 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N'-[3-[2-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxy]propyl]-N-methylethane-1,2-diamine |
| SMILES | C=C/C=C\C(=C)OCCOCCCNCCNC |
| InChI | InChI=1S/C14H26N2O2/c1-4-5-7-14(2)18-13-12-17-11-6-8-16-10-9-15-3/h4-5,7,15-16H,1-2,6,8-13H2,3H3/b7-5- |
| InChIKey | WJLXVZJOSLSAJJ-ALCCZGGFSA-N |
| XLogP | 1.47 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|