C24H32N4O — CID 171081190
(4E,7E,12E)-8-ethenyl-N-ethyl-5,15-dimethyl-6-methylidene-9-oxa-2,4,15-triazabicyclo[15.3.1]henicosa-1(20),4,7,12,17(21),18-hexaen-3-imine (PubChem CID 171081190) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is (4E,7E,12E)-8-ethenyl-N-ethyl-5,15-dimethyl-6-methylidene-9-oxa-2,4,15-triazabicyclo[15.3.1]henicosa-1(20),4,7,12,17(21),18-hexaen-3-imine.
| Compound Name | (4E,7E,12E)-8-ethenyl-N-ethyl-5,15-dimethyl-6-methylidene-9-oxa-2,4,15-triazabicyclo[15.3.1]henicosa-1(20),4,7,12,17(21),18-hexaen-3-imine |
|---|---|
| PubChem CID | 171081190 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (4E,7E,12E)-8-ethenyl-N-ethyl-5,15-dimethyl-6-methylidene-9-oxa-2,4,15-triazabicyclo[15.3.1]henicosa-1(20),4,7,12,17(21),18-hexaen-3-imine |
| SMILES | C=C/C1=C\C(=C)/C(C)=N/C(=N\CC)Nc2cccc(c2)CN(C)C/C=C/CCO1 |
| InChI | InChI=1S/C24H32N4O/c1-6-23-16-19(3)20(4)26-24(25-7-2)27-22-13-11-12-21(17-22)18-28(5)14-9-8-10-15-29-23/h6,8-9,11-13,16-17H,1,3,7,10,14-15,18H2,2,4-5H3,(H,25,27)/b9-8+,23-16+,26-20- |
| InChIKey | FRUINBGJEYURFU-FDMWRMDMSA-N |
| XLogP | 4.97 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|