C34H37N7O5S — CID 171081992
5-[4-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxamide (PubChem CID 171081992) has the molecular formula C34H37N7O5S and a molecular weight of 655.78 g/mol. Its IUPAC name is 5-[4-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxamide.
| Compound Name | 5-[4-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 171081992 |
| Molecular Formula | C34H37N7O5S |
| Molecular Weight | 655.78 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | 5-[4-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxamide |
| SMILES | CCSNc1ccc(Oc2cccc(OCCOC3CCN(c4cnc(C(N)=O)nc4)CC3)c2)c(-c2cn(C)c(=O)c3[nH]ccc23)c1 |
| InChI | InChI=1S/C34H37N7O5S/c1-3-47-39-22-7-8-30(28(17-22)29-21-40(2)34(43)31-27(29)9-12-36-31)46-26-6-4-5-25(18-26)45-16-15-44-24-10-13-41(14-11-24)23-19-37-33(32(35)42)38-20-23/h4-9,12,17-21,24,36,39H,3,10-11,13-16H2,1-2H3,(H2,35,42) |
| InChIKey | DZFNOWMTGXCAES-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.78 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|