C34H36N6O6S — CID 171082013
5-[4-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxylic acid (PubChem CID 171082013) has the molecular formula C34H36N6O6S and a molecular weight of 656.77 g/mol. Its IUPAC name is 5-[4-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxylic acid.
| Compound Name | 5-[4-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 171082013 |
| Molecular Formula | C34H36N6O6S |
| Molecular Weight | 656.77 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | 5-[4-[2-[3-[4-(ethylsulfanylamino)-2-(6-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxylic acid |
| SMILES | CCSNc1ccc(Oc2cccc(OCCOC3CCN(c4cnc(C(=O)O)nc4)CC3)c2)c(-c2cn(C)c(=O)c3[nH]ccc23)c1 |
| InChI | InChI=1S/C34H36N6O6S/c1-3-47-38-22-7-8-30(28(17-22)29-21-39(2)33(41)31-27(29)9-12-35-31)46-26-6-4-5-25(18-26)45-16-15-44-24-10-13-40(14-11-24)23-19-36-32(34(42)43)37-20-23/h4-9,12,17-21,24,35,38H,3,10-11,13-16H2,1-2H3,(H,42,43) |
| InChIKey | LMXXLACIIOEJBL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 143.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.77 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|