C30H35N3O6S — CID 171082228
4-[5-(ethylsulfonylmethyl)-2-[3-(2-piperidin-4-yloxyethoxy)phenoxy]phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 171082228) has the molecular formula C30H35N3O6S and a molecular weight of 565.69 g/mol. Its IUPAC name is 4-[5-(ethylsulfonylmethyl)-2-[3-(2-piperidin-4-yloxyethoxy)phenoxy]phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[5-(ethylsulfonylmethyl)-2-[3-(2-piperidin-4-yloxyethoxy)phenoxy]phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 171082228 |
| Molecular Formula | C30H35N3O6S |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 4-[5-(ethylsulfonylmethyl)-2-[3-(2-piperidin-4-yloxyethoxy)phenoxy]phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | CCS(=O)(=O)Cc1ccc(Oc2cccc(OCCOC3CCNCC3)c2)c(-c2cn(C)c(=O)c3[nH]ccc23)c1 |
| InChI | InChI=1S/C30H35N3O6S/c1-3-40(35,36)20-21-7-8-28(26(17-21)27-19-33(2)30(34)29-25(27)11-14-32-29)39-24-6-4-5-23(18-24)38-16-15-37-22-9-12-31-13-10-22/h4-8,11,14,17-19,22,31-32H,3,9-10,12-13,15-16,20H2,1-2H3 |
| InChIKey | HFMQOJJKWMZDJR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|