C21H28O2 — CID 171082478
1-[2-(3-methylbutoxy)propan-2-yl]-3-phenylmethoxybenzene (PubChem CID 171082478) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 1-[2-(3-methylbutoxy)propan-2-yl]-3-phenylmethoxybenzene.
| Compound Name | 1-[2-(3-methylbutoxy)propan-2-yl]-3-phenylmethoxybenzene |
|---|---|
| PubChem CID | 171082478 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-[2-(3-methylbutoxy)propan-2-yl]-3-phenylmethoxybenzene |
| SMILES | CC(C)CCOC(C)(C)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H28O2/c1-17(2)13-14-23-21(3,4)19-11-8-12-20(15-19)22-16-18-9-6-5-7-10-18/h5-12,15,17H,13-14,16H2,1-4H3 |
| InChIKey | GEZKTHOUGQNTDH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |