C35H39IN6O6S — CID 171082776
ethane;methyl 5-[4-[2-[3-[4-amino-2-(1-iodosulfanyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxylate (PubChem CID 171082776) has the molecular formula C35H39IN6O6S and a molecular weight of 798.70 g/mol. Its IUPAC name is ethane;methyl 5-[4-[2-[3-[4-amino-2-(1-iodosulfanyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxylate.
| Compound Name | ethane;methyl 5-[4-[2-[3-[4-amino-2-(1-iodosulfanyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 171082776 |
| Molecular Formula | C35H39IN6O6S |
| Molecular Weight | 798.70 g/mol |
| Exact Mass | 798.17 |
| IUPAC Name | ethane;methyl 5-[4-[2-[3-[4-amino-2-(1-iodosulfanyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)phenoxy]phenoxy]ethoxy]piperidin-1-yl]pyrimidine-2-carboxylate |
| SMILES | CC.COC(=O)c1ncc(N2CCC(OCCOc3cccc(Oc4ccc(N)cc4-c4cn(C)c(=O)c5c4ccn5SI)c3)CC2)cn1 |
| InChI | InChI=1S/C33H33IN6O6S.C2H6/c1-38-20-28(26-10-13-40(47-34)30(26)32(38)41)27-16-21(35)6-7-29(27)46-25-5-3-4-24(17-25)45-15-14-44-23-8-11-39(12-9-23)22-18-36-31(37-19-22)33(42)43-2;1-2/h3-7,10,13,16-20,23H,8-9,11-12,14-15,35H2,1-2H3;1-2H3 |
| InChIKey | LYIZIWBPCLKPGW-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.70 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|