About [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite
[4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite (PubChem CID 171082827) has the molecular formula C17H17IN2O3S
and a molecular weight of 456.31 g/mol. Its IUPAC name is [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite.
Molecular Properties
| Compound Name | [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite |
| PubChem CID | 171082827 |
| Molecular Formula | C17H17IN2O3S |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite |
| SMILES | Cn1cc(-c2cc(C(C)(C)O)ccc2O)c2ccn(SI)c2c1=O |
| InChI | InChI=1S/C17H17IN2O3S/c1-17(2,23)10-4-5-14(21)12(8-10)13-9-19(3)16(22)15-11(13)6-7-20(15)24-18/h4-9,21,23H,1-3H3 |
| InChIKey | KCDUKRQGJLOCLF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite?
The IUPAC name of [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite (CID 171082827) is [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite.
What is the SMILES notation for [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite?
The canonical SMILES for [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite is Cn1cc(-c2cc(C(C)(C)O)ccc2O)c2ccn(SI)c2c1=O.
What is the InChIKey of [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite?
The InChIKey is KCDUKRQGJLOCLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17IN2O3S/c1-17(2,23)10-4-5-14(21)12(8-10)13-9-19(3)16(22)15-11(13)6-7-20(15)24-18/h4-9,21,23H,1-3H3.
What are the key properties of [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite?
[4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite has a molecular weight of 456.31 g/mol, XLogP of 3.79, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-hydroxy-5-(2-hydroxypropan-2-yl)phenyl]-6-methyl-7-oxopyrrolo[2,3-c]pyridin-1-yl] thiohypoiodite is sourced from PubChem (CID 171082827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).