C17H20N2O — CID 171083388
4-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-4-yl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 171083388) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-4-yl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-4-yl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 171083388 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-4-yl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | C=C(C)/C=C(C(\C)=C/C)/c1cn(C)c(=O)c2[nH]ccc12 |
| InChI | InChI=1S/C17H20N2O/c1-6-12(4)14(9-11(2)3)15-10-19(5)17(20)16-13(15)7-8-18-16/h6-10,18H,2H2,1,3-5H3/b12-6-,14-9+ |
| InChIKey | XQWYAHCKSICNJN-VXQHEWBCSA-N |
| XLogP | 3.79 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|