C19H27N3OSi — CID 171084513
3,5-dimethyl-1-(oxan-2-yl)-4-(2-trimethylsilylethynyl)indazol-6-amine (PubChem CID 171084513) has the molecular formula C19H27N3OSi and a molecular weight of 341.53 g/mol. Its IUPAC name is 3,5-dimethyl-1-(oxan-2-yl)-4-(2-trimethylsilylethynyl)indazol-6-amine.
| Compound Name | 3,5-dimethyl-1-(oxan-2-yl)-4-(2-trimethylsilylethynyl)indazol-6-amine |
|---|---|
| PubChem CID | 171084513 |
| Molecular Formula | C19H27N3OSi |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3,5-dimethyl-1-(oxan-2-yl)-4-(2-trimethylsilylethynyl)indazol-6-amine |
| SMILES | Cc1c(N)cc2c(c(C)nn2C2CCCCO2)c1C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H27N3OSi/c1-13-15(9-11-24(3,4)5)19-14(2)21-22(17(19)12-16(13)20)18-8-6-7-10-23-18/h12,18H,6-8,10,20H2,1-5H3 |
| InChIKey | WJMNUVDQUCJTSJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|