About 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol
3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol (PubChem CID 171084790) has the molecular formula C14H16F2N4O4
and a molecular weight of 342.30 g/mol. Its IUPAC name is 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol.
Molecular Properties
| Compound Name | 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol |
| PubChem CID | 171084790 |
| Molecular Formula | C14H16F2N4O4 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol |
| SMILES | Cc1c([N+](=O)[O-])c(OCCCO)nn1-c1cccnc1C(C)(F)F |
| InChI | InChI=1S/C14H16F2N4O4/c1-9-11(20(22)23)13(24-8-4-7-21)18-19(9)10-5-3-6-17-12(10)14(2,15)16/h3,5-6,21H,4,7-8H2,1-2H3 |
| InChIKey | GERRJISVKKBMNF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol?
The IUPAC name of 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol (CID 171084790) is 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol.
What is the SMILES notation for 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol?
The canonical SMILES for 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol is Cc1c([N+](=O)[O-])c(OCCCO)nn1-c1cccnc1C(C)(F)F.
What is the InChIKey of 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol?
The InChIKey is GERRJISVKKBMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N4O4/c1-9-11(20(22)23)13(24-8-4-7-21)18-19(9)10-5-3-6-17-12(10)14(2,15)16/h3,5-6,21H,4,7-8H2,1-2H3.
What are the key properties of 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol?
3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol has a molecular weight of 342.30 g/mol, XLogP of 2.36, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[2-(1,1-difluoroethyl)-3-pyridinyl]-5-methyl-4-nitropyrazol-3-yl]oxypropan-1-ol is sourced from PubChem (CID 171084790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).