About 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol
2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol (PubChem CID 171085595) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol |
| PubChem CID | 171085595 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(-c2ccc3ccc(C4CC(C)(O)C4)nc3n2)c(O)c1 |
| InChI | InChI=1S/C21H22N2O2/c1-12-8-13(2)19(18(24)9-12)17-7-5-14-4-6-16(22-20(14)23-17)15-10-21(3,25)11-15/h4-9,15,24-25H,10-11H2,1-3H3 |
| InChIKey | PWZATVXEKBSRSF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol?
The IUPAC name of 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol (CID 171085595) is 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol.
What is the SMILES notation for 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol?
The canonical SMILES for 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol is Cc1cc(C)c(-c2ccc3ccc(C4CC(C)(O)C4)nc3n2)c(O)c1.
What is the InChIKey of 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol?
The InChIKey is PWZATVXEKBSRSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2/c1-12-8-13(2)19(18(24)9-12)17-7-5-14-4-6-16(22-20(14)23-17)15-10-21(3,25)11-15/h4-9,15,24-25H,10-11H2,1-3H3.
What are the key properties of 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol?
2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol has a molecular weight of 334.42 g/mol, XLogP of 4.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-(3-hydroxy-3-methylcyclobutyl)-1,8-naphthyridin-2-yl]-3,5-dimethylphenol is sourced from PubChem (CID 171085595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).