C36H40N4O2Si — CID 171085750
2-[3-[3-[tert-butyl(diphenyl)silyl]oxypiperidin-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3,5-dimethylphenol (PubChem CID 171085750) has the molecular formula C36H40N4O2Si and a molecular weight of 588.83 g/mol. Its IUPAC name is 2-[3-[3-[tert-butyl(diphenyl)silyl]oxypiperidin-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3,5-dimethylphenol.
| Compound Name | 2-[3-[3-[tert-butyl(diphenyl)silyl]oxypiperidin-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 171085750 |
| Molecular Formula | C36H40N4O2Si |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 2-[3-[3-[tert-butyl(diphenyl)silyl]oxypiperidin-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(-c2ccc3ncc(C4CCNCC4O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)nc3n2)c(O)c1 |
| InChI | InChI=1S/C36H40N4O2Si/c1-24-20-25(2)34(32(41)21-24)29-16-17-30-35(39-29)40-31(22-38-30)28-18-19-37-23-33(28)42-43(36(3,4)5,26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-17,20-22,28,33,37,41H,18-19,23H2,1-5H3 |
| InChIKey | DIKPVPNHTHQSLZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|