C30H36F3N5O3 — CID 171086157
N-[(1R)-1-[3-methoxy-5-(1-methylpyrazol-4-yl)phenyl]ethyl]-2-methyl-5-[(1R,5S)-8-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 171086157) has the molecular formula C30H36F3N5O3 and a molecular weight of 571.64 g/mol. Its IUPAC name is N-[(1R)-1-[3-methoxy-5-(1-methylpyrazol-4-yl)phenyl]ethyl]-2-methyl-5-[(1R,5S)-8-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | N-[(1R)-1-[3-methoxy-5-(1-methylpyrazol-4-yl)phenyl]ethyl]-2-methyl-5-[(1R,5S)-8-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 171086157 |
| Molecular Formula | C30H36F3N5O3 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | N-[(1R)-1-[3-methoxy-5-(1-methylpyrazol-4-yl)phenyl]ethyl]-2-methyl-5-[(1R,5S)-8-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]-3,8-diazabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | COc1cc(-c2cnn(C)c2)cc([C@@H](C)NC(=O)c2cc(N3C[C@H]4CC[C@@H](C3)N4C[C@@H](O)C(F)(F)F)ccc2C)c1 |
| InChI | InChI=1S/C30H36F3N5O3/c1-18-5-6-23(37-15-24-7-8-25(16-37)38(24)17-28(39)30(31,32)33)12-27(18)29(40)35-19(2)20-9-21(11-26(10-20)41-4)22-13-34-36(3)14-22/h5-6,9-14,19,24-25,28,39H,7-8,15-17H2,1-4H3,(H,35,40)/t19-,24-,25+,28-/m1/s1 |
| InChIKey | PGNZVRIYZYOIRN-BBUZLNLBSA-N |
| XLogP | 4.47 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |