C29H39N5O3 — CID 171086253
N-[(1R)-1-[3-(2-ethoxyethoxy)-5-(1-methylpyrazol-4-yl)phenyl]ethyl]-2-methyl-5-(4-methylpiperazin-1-yl)benzamide (PubChem CID 171086253) has the molecular formula C29H39N5O3 and a molecular weight of 505.66 g/mol. Its IUPAC name is N-[(1R)-1-[3-(2-ethoxyethoxy)-5-(1-methylpyrazol-4-yl)phenyl]ethyl]-2-methyl-5-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[(1R)-1-[3-(2-ethoxyethoxy)-5-(1-methylpyrazol-4-yl)phenyl]ethyl]-2-methyl-5-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 171086253 |
| Molecular Formula | C29H39N5O3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | N-[(1R)-1-[3-(2-ethoxyethoxy)-5-(1-methylpyrazol-4-yl)phenyl]ethyl]-2-methyl-5-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CCOCCOc1cc(-c2cnn(C)c2)cc([C@@H](C)NC(=O)c2cc(N3CCN(C)CC3)ccc2C)c1 |
| InChI | InChI=1S/C29H39N5O3/c1-6-36-13-14-37-27-16-23(15-24(17-27)25-19-30-33(5)20-25)22(3)31-29(35)28-18-26(8-7-21(28)2)34-11-9-32(4)10-12-34/h7-8,15-20,22H,6,9-14H2,1-5H3,(H,31,35)/t22-/m1/s1 |
| InChIKey | HWOFLKWTYFJONQ-JOCHJYFZSA-N |
| XLogP | 4.05 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|