C17H26 — CID 171086700
4,7-dimethyl-10-propan-2-yl-5,6,7,8,9,10-hexahydrobenzo[8]annulene (PubChem CID 171086700) has the molecular formula C17H26 and a molecular weight of 230.40 g/mol. Its IUPAC name is 4,7-dimethyl-10-propan-2-yl-5,6,7,8,9,10-hexahydrobenzo[8]annulene.
| Compound Name | 4,7-dimethyl-10-propan-2-yl-5,6,7,8,9,10-hexahydrobenzo[8]annulene |
|---|---|
| PubChem CID | 171086700 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 4,7-dimethyl-10-propan-2-yl-5,6,7,8,9,10-hexahydrobenzo[8]annulene |
| SMILES | Cc1cccc2c1CCC(C)CCC2C(C)C |
| InChI | InChI=1S/C17H26/c1-12(2)15-10-8-13(3)9-11-16-14(4)6-5-7-17(15)16/h5-7,12-13,15H,8-11H2,1-4H3 |
| InChIKey | XAYFCEIMGZCJTK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |