C15H20INO2 — CID 171086813
tert-butyl 5-iodo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 171086813) has the molecular formula C15H20INO2 and a molecular weight of 373.23 g/mol. Its IUPAC name is tert-butyl 5-iodo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 5-iodo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 171086813 |
| Molecular Formula | C15H20INO2 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | tert-butyl 5-iodo-1-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC1c2cccc(I)c2CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20INO2/c1-10-11-6-5-7-13(16)12(11)8-9-17(10)14(18)19-15(2,3)4/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | DZCGPCMDWAFNSW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|