About (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine
(11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine (PubChem CID 171086896) has the molecular formula C15H16N3P
and a molecular weight of 269.29 g/mol. Its IUPAC name is (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine.
Molecular Properties
| Compound Name | (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine |
| PubChem CID | 171086896 |
| Molecular Formula | C15H16N3P |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine |
| SMILES | N/C1=C(\NP)c2ccccc2NCc2ccccc21 |
| InChI | InChI=1S/C15H16N3P/c16-14-11-6-2-1-5-10(11)9-17-13-8-4-3-7-12(13)15(14)18-19/h1-8,17-18H,9,16,19H2/b15-14- |
| InChIKey | NJRLYSSCDGFMMN-PFONDFGASA-N |
| XLogP | 2.78 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine?
The IUPAC name of (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine (CID 171086896) is (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine.
What is the SMILES notation for (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine?
The canonical SMILES for (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine is N/C1=C(\NP)c2ccccc2NCc2ccccc21.
What is the InChIKey of (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine?
The InChIKey is NJRLYSSCDGFMMN-PFONDFGASA-N. The full InChI is InChI=1S/C15H16N3P/c16-14-11-6-2-1-5-10(11)9-17-13-8-4-3-7-12(13)15(14)18-19/h1-8,17-18H,9,16,19H2/b15-14-.
What are the key properties of (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine?
(11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine has a molecular weight of 269.29 g/mol, XLogP of 2.78, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (11Z)-12-N-phosphanyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine is sourced from PubChem (CID 171086896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).