C20H21CsF3N5OS2 — CID 171087280
cesium;carbanide;S-[4-[[5-[3-[[4-(trifluoromethyl)-1,2-thiazol-3-yl]oxymethyl]cyclobutyl]pyrimidin-2-yl]amino]phenyl]thiohydroxylamine (PubChem CID 171087280) has the molecular formula C20H21CsF3N5OS2 and a molecular weight of 601.46 g/mol. Its IUPAC name is cesium;carbanide;S-[4-[[5-[3-[[4-(trifluoromethyl)-1,2-thiazol-3-yl]oxymethyl]cyclobutyl]pyrimidin-2-yl]amino]phenyl]thiohydroxylamine.
| Compound Name | cesium;carbanide;S-[4-[[5-[3-[[4-(trifluoromethyl)-1,2-thiazol-3-yl]oxymethyl]cyclobutyl]pyrimidin-2-yl]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 171087280 |
| Molecular Formula | C20H21CsF3N5OS2 |
| Molecular Weight | 601.46 g/mol |
| Exact Mass | 601.02 |
| IUPAC Name | cesium;carbanide;S-[4-[[5-[3-[[4-(trifluoromethyl)-1,2-thiazol-3-yl]oxymethyl]cyclobutyl]pyrimidin-2-yl]amino]phenyl]thiohydroxylamine |
| SMILES | NSc1ccc(Nc2ncc(C3CC(COc4nscc4C(F)(F)F)C3)cn2)cc1.[CH3-].[Cs+] |
| InChI | InChI=1S/C19H18F3N5OS2.CH3.Cs/c20-19(21,22)16-10-29-27-17(16)28-9-11-5-12(6-11)13-7-24-18(25-8-13)26-14-1-3-15(30-23)4-2-14;;/h1-4,7-8,10-12H,5-6,9,23H2,(H,24,25,26);1H3;/q;-1;+1 |
| InChIKey | VPYUBOBZIVZSKB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|