C20H22F5N5O4S — CID 171087297
[(1R,3S)-3-[2-(2,6-difluoro-4-sulfamoylanilino)pyrimidin-5-yl]cyclopentyl] N-[(2S)-4,4,4-trifluorobutan-2-yl]carbamate (PubChem CID 171087297) has the molecular formula C20H22F5N5O4S and a molecular weight of 523.48 g/mol. Its IUPAC name is [(1R,3S)-3-[2-(2,6-difluoro-4-sulfamoylanilino)pyrimidin-5-yl]cyclopentyl] N-[(2S)-4,4,4-trifluorobutan-2-yl]carbamate.
| Compound Name | [(1R,3S)-3-[2-(2,6-difluoro-4-sulfamoylanilino)pyrimidin-5-yl]cyclopentyl] N-[(2S)-4,4,4-trifluorobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 171087297 |
| Molecular Formula | C20H22F5N5O4S |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [(1R,3S)-3-[2-(2,6-difluoro-4-sulfamoylanilino)pyrimidin-5-yl]cyclopentyl] N-[(2S)-4,4,4-trifluorobutan-2-yl]carbamate |
| SMILES | C[C@@H](CC(F)(F)F)NC(=O)O[C@@H]1CC[C@H](c2cnc(Nc3c(F)cc(S(N)(=O)=O)cc3F)nc2)C1 |
| InChI | InChI=1S/C20H22F5N5O4S/c1-10(7-20(23,24)25)29-19(31)34-13-3-2-11(4-13)12-8-27-18(28-9-12)30-17-15(21)5-14(6-16(17)22)35(26,32)33/h5-6,8-11,13H,2-4,7H2,1H3,(H,29,31)(H2,26,32,33)(H,27,28,30)/t10-,11-,13+/m0/s1 |
| InChIKey | SXWOLOACLWIJKD-GMXVVIOVSA-N |
| XLogP | 3.85 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |