C22H22F3N5OS — CID 171087437
S-[4-[[5-[3-[[4-(2,2,2-trifluoroethyl)-3-pyridinyl]oxy]cyclopentyl]pyrimidin-2-yl]amino]phenyl]thiohydroxylamine (PubChem CID 171087437) has the molecular formula C22H22F3N5OS and a molecular weight of 461.51 g/mol. Its IUPAC name is S-[4-[[5-[3-[[4-(2,2,2-trifluoroethyl)-3-pyridinyl]oxy]cyclopentyl]pyrimidin-2-yl]amino]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[[5-[3-[[4-(2,2,2-trifluoroethyl)-3-pyridinyl]oxy]cyclopentyl]pyrimidin-2-yl]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 171087437 |
| Molecular Formula | C22H22F3N5OS |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | S-[4-[[5-[3-[[4-(2,2,2-trifluoroethyl)-3-pyridinyl]oxy]cyclopentyl]pyrimidin-2-yl]amino]phenyl]thiohydroxylamine |
| SMILES | NSc1ccc(Nc2ncc(C3CCC(Oc4cnccc4CC(F)(F)F)C3)cn2)cc1 |
| InChI | InChI=1S/C22H22F3N5OS/c23-22(24,25)10-15-7-8-27-13-20(15)31-18-4-1-14(9-18)16-11-28-21(29-12-16)30-17-2-5-19(32-26)6-3-17/h2-3,5-8,11-14,18H,1,4,9-10,26H2,(H,28,29,30) |
| InChIKey | FMCOMMXGUHNRTP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|