About (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine
(Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine (PubChem CID 171087921) has the molecular formula C7H12F2N2
and a molecular weight of 162.18 g/mol. Its IUPAC name is (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine |
| PubChem CID | 171087921 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine |
| SMILES | CCC(=C/N)/C=N/CC(F)F |
| InChI | InChI=1S/C7H12F2N2/c1-2-6(3-10)4-11-5-7(8)9/h3-4,7H,2,5,10H2,1H3/b6-3-,11-4+ |
| InChIKey | FSPCDAZNGUBCEA-WVVGTSEZSA-N |
| XLogP | 1.57 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine?
The IUPAC name of (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine (CID 171087921) is (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine.
What is the SMILES notation for (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine?
The canonical SMILES for (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine is CCC(=C/N)/C=N/CC(F)F.
What is the InChIKey of (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine?
The InChIKey is FSPCDAZNGUBCEA-WVVGTSEZSA-N. The full InChI is InChI=1S/C7H12F2N2/c1-2-6(3-10)4-11-5-7(8)9/h3-4,7H,2,5,10H2,1H3/b6-3-,11-4+.
What are the key properties of (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine?
(Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine has a molecular weight of 162.18 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2,2-difluoroethyliminomethyl)but-1-en-1-amine is sourced from PubChem (CID 171087921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).